C10H10F3O4P — CID 10062280
(2R,4R)-4-phenyl-2-(2,2,2-trifluoroethoxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 10062280) has the molecular formula C10H10F3O4P and a molecular weight of 282.15 g/mol. Its IUPAC name is (2R,4R)-4-phenyl-2-(2,2,2-trifluoroethoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | (2R,4R)-4-phenyl-2-(2,2,2-trifluoroethoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 10062280 |
| Molecular Formula | C10H10F3O4P |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | (2R,4R)-4-phenyl-2-(2,2,2-trifluoroethoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=[P@]1(OCC(F)(F)F)OC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H10F3O4P/c11-10(12,13)7-16-18(14)15-6-9(17-18)8-4-2-1-3-5-8/h1-5,9H,6-7H2/t9-,18+/m0/s1 |
| InChIKey | MLYAMHYSIJTKHA-NIVTXAMTSA-N |
| XLogP | 3.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|