About 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde
7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde (PubChem CID 10062303) has the molecular formula C18H18O3
and a molecular weight of 282.34 g/mol. Its IUPAC name is 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde |
| PubChem CID | 10062303 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde |
| SMILES | COc1cc(C=O)c2c(c1C)CCc1c-2ccc(O)c1C |
| InChI | InChI=1S/C18H18O3/c1-10-13-4-5-14-11(2)17(21-3)8-12(9-19)18(14)15(13)6-7-16(10)20/h6-9,20H,4-5H2,1-3H3 |
| InChIKey | VWSRJHXOXSHKMB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde?
The IUPAC name of 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde (CID 10062303) is 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde.
What is the SMILES notation for 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde?
The canonical SMILES for 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde is COc1cc(C=O)c2c(c1C)CCc1c-2ccc(O)c1C.
What is the InChIKey of 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde?
The InChIKey is VWSRJHXOXSHKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O3/c1-10-13-4-5-14-11(2)17(21-3)8-12(9-19)18(14)15(13)6-7-16(10)20/h6-9,20H,4-5H2,1-3H3.
What are the key properties of 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde?
7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde has a molecular weight of 282.34 g/mol, XLogP of 3.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2-methoxy-1,8-dimethyl-9,10-dihydrophenanthrene-4-carbaldehyde is sourced from PubChem (CID 10062303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).