C14H22N2O4 — CID 10062304
[4-(methylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 10062304) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is [4-(methylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [4-(methylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10062304 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [4-(methylamino)-4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CNC1CCCc2onc(OCOC(=O)C(C)(C)C)c21 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)13(17)19-8-18-12-11-9(15-4)6-5-7-10(11)20-16-12/h9,15H,5-8H2,1-4H3 |
| InChIKey | IUASSYDNPFIYAT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|