C16H10FNOS — CID 10062363
9-fluoro-4-methyl-13-oxa-3-thia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaene (PubChem CID 10062363) has the molecular formula C16H10FNOS and a molecular weight of 283.33 g/mol. Its IUPAC name is 9-fluoro-4-methyl-13-oxa-3-thia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaene.
| Compound Name | 9-fluoro-4-methyl-13-oxa-3-thia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaene |
|---|---|
| PubChem CID | 10062363 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 9-fluoro-4-methyl-13-oxa-3-thia-5-azatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7(12),8,10,14,16-octaene |
| SMILES | Cc1nc2c(s1)-c1ccccc1Oc1ccc(F)cc1-2 |
| InChI | InChI=1S/C16H10FNOS/c1-9-18-15-12-8-10(17)6-7-14(12)19-13-5-3-2-4-11(13)16(15)20-9/h2-8H,1H3 |
| InChIKey | WQTCKGFCFBQLEL-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |