C14H21N5O2 — CID 100624368
(4-methylpiperazin-1-yl)-[(3R)-3-pyridazin-3-yloxypyrrolidin-1-yl]methanone (PubChem CID 100624368) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-[(3R)-3-pyridazin-3-yloxypyrrolidin-1-yl]methanone.
| Compound Name | (4-methylpiperazin-1-yl)-[(3R)-3-pyridazin-3-yloxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 100624368 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (4-methylpiperazin-1-yl)-[(3R)-3-pyridazin-3-yloxypyrrolidin-1-yl]methanone |
| SMILES | CN1CCN(C(=O)N2CC[C@@H](Oc3cccnn3)C2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c1-17-7-9-18(10-8-17)14(20)19-6-4-12(11-19)21-13-3-2-5-15-16-13/h2-3,5,12H,4,6-11H2,1H3/t12-/m1/s1 |
| InChIKey | CPNPTCZKLMWIRC-GFCCVEGCSA-N |
| XLogP | 0.30 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |