C28H35N5O4 — CID 100625213
(1S,9S)-N-[(2S)-1-[2-(5-methoxyindol-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide (PubChem CID 100625213) has the molecular formula C28H35N5O4 and a molecular weight of 505.62 g/mol. Its IUPAC name is (1S,9S)-N-[(2S)-1-[2-(5-methoxyindol-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide.
| Compound Name | (1S,9S)-N-[(2S)-1-[2-(5-methoxyindol-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 100625213 |
| Molecular Formula | C28H35N5O4 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | (1S,9S)-N-[(2S)-1-[2-(5-methoxyindol-1-yl)ethylamino]-3-methyl-1-oxobutan-2-yl]-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
| SMILES | COc1ccc2c(ccn2CCNC(=O)[C@@H](NC(=O)N2C[C@H]3C[C@@H](C2)c2cccc(=O)n2C3)C(C)C)c1 |
| InChI | InChI=1S/C28H35N5O4/c1-18(2)26(27(35)29-10-12-31-11-9-20-14-22(37-3)7-8-23(20)31)30-28(36)32-15-19-13-21(17-32)24-5-4-6-25(34)33(24)16-19/h4-9,11,14,18-19,21,26H,10,12-13,15-17H2,1-3H3,(H,29,35)(H,30,36)/t19-,21+,26+/m1/s1 |
| InChIKey | COWJGRZBLKVRGD-DYRZZGSRSA-N |
| XLogP | 2.78 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |