C16H38N4 — CID 10062564
N-ethyl-N'-[3-[3-[[(2S)-2-methylbutyl]amino]propylamino]propyl]propane-1,3-diamine (PubChem CID 10062564) has the molecular formula C16H38N4 and a molecular weight of 286.51 g/mol. Its IUPAC name is N-ethyl-N'-[3-[3-[[(2S)-2-methylbutyl]amino]propylamino]propyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-[3-[3-[[(2S)-2-methylbutyl]amino]propylamino]propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 10062564 |
| Molecular Formula | C16H38N4 |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.31 |
| IUPAC Name | N-ethyl-N'-[3-[3-[[(2S)-2-methylbutyl]amino]propylamino]propyl]propane-1,3-diamine |
| SMILES | CCNCCCNCCCNCCCNC[C@@H](C)CC |
| InChI | InChI=1S/C16H38N4/c1-4-16(3)15-20-14-8-13-19-12-7-11-18-10-6-9-17-5-2/h16-20H,4-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | DTBWMCBBPNCISD-INIZCTEOSA-N |
| XLogP | 1.58 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|