C20H32O — CID 10062670
(3aR,6R,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydro-2H-cyclopenta[11]annulen-4-one (PubChem CID 10062670) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is (3aR,6R,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydro-2H-cyclopenta[11]annulen-4-one.
| Compound Name | (3aR,6R,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydro-2H-cyclopenta[11]annulen-4-one |
|---|---|
| PubChem CID | 10062670 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (3aR,6R,9E,12aR)-3a,6,10-trimethyl-1-propan-2-ylidene-3,5,6,7,8,11,12,12a-octahydro-2H-cyclopenta[11]annulen-4-one |
| SMILES | CC(C)=C1CC[C@@]2(C)C(=O)C[C@H](C)CC/C=C(\C)CC[C@H]12 |
| InChI | InChI=1S/C20H32O/c1-14(2)17-11-12-20(5)18(17)10-9-15(3)7-6-8-16(4)13-19(20)21/h7,16,18H,6,8-13H2,1-5H3/b15-7+/t16-,18-,20-/m1/s1 |
| InChIKey | AMAPASJFIMKPND-ILUKQUFFSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|