About N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide
N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide (PubChem CID 10062685) has the molecular formula C15H15NO5
and a molecular weight of 289.29 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide |
| PubChem CID | 10062685 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H15NO5/c17-11-3-1-9(7-13(11)19)5-6-16-15(21)10-2-4-12(18)14(20)8-10/h1-4,7-8,17-20H,5-6H2,(H,16,21) |
| InChIKey | XRVIWWMFPXBKLJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide?
The IUPAC name of N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide (CID 10062685) is N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide.
What is the SMILES notation for N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide?
The canonical SMILES for N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide is O=C(NCCc1ccc(O)c(O)c1)c1ccc(O)c(O)c1.
What is the InChIKey of N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide?
The InChIKey is XRVIWWMFPXBKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO5/c17-11-3-1-9(7-13(11)19)5-6-16-15(21)10-2-4-12(18)14(20)8-10/h1-4,7-8,17-20H,5-6H2,(H,16,21).
What are the key properties of N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide?
N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide has a molecular weight of 289.29 g/mol, XLogP of 1.48, 4 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydroxyphenyl)ethyl]-3,4-dihydroxybenzamide is sourced from PubChem (CID 10062685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).