C33H36ClN3O4S — CID 100628439
(2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]acetyl]amino]-3-phenylpropanamide (PubChem CID 100628439) has the molecular formula C33H36ClN3O4S and a molecular weight of 606.19 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100628439 |
| Molecular Formula | C33H36ClN3O4S |
| Molecular Weight | 606.19 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | (2S)-N-butyl-2-[(3-chlorophenyl)methyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)CN(C)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C33H36ClN3O4S/c1-3-4-19-35-33(39)31(21-25-11-6-5-7-12-25)37(23-26-13-10-16-29(34)20-26)32(38)24-36(2)42(40,41)30-18-17-27-14-8-9-15-28(27)22-30/h5-18,20,22,31H,3-4,19,21,23-24H2,1-2H3,(H,35,39)/t31-/m0/s1 |
| InChIKey | LZFYQQOYWFATGG-HKBQPEDESA-N |
| XLogP | 5.67 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.19 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|