C17H16N4O — CID 10062914
1'-methylspiro[2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-16,2'-pyrrolidine]-7-one (PubChem CID 10062914) has the molecular formula C17H16N4O and a molecular weight of 292.34 g/mol. Its IUPAC name is 1'-methylspiro[2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-16,2'-pyrrolidine]-7-one.
| Compound Name | 1'-methylspiro[2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-16,2'-pyrrolidine]-7-one |
|---|---|
| PubChem CID | 10062914 |
| Molecular Formula | C17H16N4O |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 1'-methylspiro[2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-16,2'-pyrrolidine]-7-one |
| SMILES | CN1CCCC12c1ccccc1-c1[nH]c(=O)c3nccn3c12 |
| InChI | InChI=1S/C17H16N4O/c1-20-9-4-7-17(20)12-6-3-2-5-11(12)13-14(17)21-10-8-18-15(21)16(22)19-13/h2-3,5-6,8,10H,4,7,9H2,1H3,(H,19,22) |
| InChIKey | PRRDAGLZCPRXTP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |