C33H39BrN2O3 — CID 100629347
N-[(3-bromophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methylphenoxy)butanamide (PubChem CID 100629347) has the molecular formula C33H39BrN2O3 and a molecular weight of 591.59 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methylphenoxy)butanamide.
| Compound Name | N-[(3-bromophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 100629347 |
| Molecular Formula | C33H39BrN2O3 |
| Molecular Weight | 591.59 g/mol |
| Exact Mass | 590.21 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-[(2R)-1-(cyclohexylamino)-1-oxo-3-phenylpropan-2-yl]-4-(4-methylphenoxy)butanamide |
| SMILES | Cc1ccc(OCCCC(=O)N(Cc2cccc(Br)c2)[C@H](Cc2ccccc2)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C33H39BrN2O3/c1-25-17-19-30(20-18-25)39-21-9-16-32(37)36(24-27-12-8-13-28(34)22-27)31(23-26-10-4-2-5-11-26)33(38)35-29-14-6-3-7-15-29/h2,4-5,8,10-13,17-20,22,29,31H,3,6-7,9,14-16,21,23-24H2,1H3,(H,35,38)/t31-/m1/s1 |
| InChIKey | TWLHXUCGZHVFQY-WJOKGBTCSA-N |
| XLogP | 7.01 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.59 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|