C24H34N2O3 — CID 100629782
(3aS,7aS)-2-[(2R)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 100629782) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (3aS,7aS)-2-[(2R)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aS)-2-[(2R)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 100629782 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (3aS,7aS)-2-[(2R)-1-[(6R)-2-azaspiro[5.5]undec-9-en-2-yl]-4-methyl-1-oxopentan-2-yl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC(C)C[C@H](C(=O)N1CCC[C@]2(CC=CCC2)C1)N1C(=O)[C@H]2CC=CC[C@@H]2C1=O |
| InChI | InChI=1S/C24H34N2O3/c1-17(2)15-20(26-21(27)18-9-4-5-10-19(18)22(26)28)23(29)25-14-8-13-24(16-25)11-6-3-7-12-24/h3-6,17-20H,7-16H2,1-2H3/t18-,19-,20+,24+/m0/s1 |
| InChIKey | UHFNYZJCUWZIHX-PWSZPPJVSA-N |
| XLogP | 3.70 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|