About 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole
3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole (PubChem CID 10063060) has the molecular formula C18H18N2S
and a molecular weight of 294.42 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole.
Molecular Properties
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole |
| PubChem CID | 10063060 |
| Molecular Formula | C18H18N2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole |
| SMILES | CN1CC=C(c2c[nH]c3ccc(-c4cccs4)cc23)CC1 |
| InChI | InChI=1S/C18H18N2S/c1-20-8-6-13(7-9-20)16-12-19-17-5-4-14(11-15(16)17)18-3-2-10-21-18/h2-6,10-12,19H,7-9H2,1H3 |
| InChIKey | QNVFHQBBAWKLGI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole?
The IUPAC name of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole (CID 10063060) is 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole.
What is the SMILES notation for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole?
The canonical SMILES for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole is CN1CC=C(c2c[nH]c3ccc(-c4cccs4)cc23)CC1.
What is the InChIKey of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole?
The InChIKey is QNVFHQBBAWKLGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2S/c1-20-8-6-13(7-9-20)16-12-19-17-5-4-14(11-15(16)17)18-3-2-10-21-18/h2-6,10-12,19H,7-9H2,1H3.
What are the key properties of 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole?
3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole has a molecular weight of 294.42 g/mol, XLogP of 4.62, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-5-thiophen-2-yl-1H-indole is sourced from PubChem (CID 10063060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).