About 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one
6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one (PubChem CID 100631156) has the molecular formula C18H14ClN3O2
and a molecular weight of 339.78 g/mol. Its IUPAC name is 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one |
| PubChem CID | 100631156 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2ccc(NCc3ncc(-c4ccccc4Cl)o3)cc21 |
| InChI | InChI=1S/C18H14ClN3O2/c19-15-4-2-1-3-13(15)16-9-21-17(24-16)10-20-12-6-5-11-8-22-18(23)14(11)7-12/h1-7,9,20H,8,10H2,(H,22,23) |
| InChIKey | IFUUZEYSCIMNTL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one?
The IUPAC name of 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one (CID 100631156) is 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one?
The canonical SMILES for 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one is O=C1NCc2ccc(NCc3ncc(-c4ccccc4Cl)o3)cc21.
What is the InChIKey of 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one?
The InChIKey is IFUUZEYSCIMNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14ClN3O2/c19-15-4-2-1-3-13(15)16-9-21-17(24-16)10-20-12-6-5-11-8-22-18(23)14(11)7-12/h1-7,9,20H,8,10H2,(H,22,23).
What are the key properties of 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one?
6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one has a molecular weight of 339.78 g/mol, XLogP of 3.85, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[5-(2-chlorophenyl)-1,3-oxazol-2-yl]methylamino]-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 100631156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).