C13H24N2O3S — CID 100632064
methyl 2-[2-[[(1R,2R)-2-aminocycloheptanecarbonyl]amino]ethylsulfanyl]acetate (PubChem CID 100632064) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is methyl 2-[2-[[(1R,2R)-2-aminocycloheptanecarbonyl]amino]ethylsulfanyl]acetate.
| Compound Name | methyl 2-[2-[[(1R,2R)-2-aminocycloheptanecarbonyl]amino]ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 100632064 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | methyl 2-[2-[[(1R,2R)-2-aminocycloheptanecarbonyl]amino]ethylsulfanyl]acetate |
| SMILES | COC(=O)CSCCNC(=O)[C@@H]1CCCCC[C@H]1N |
| InChI | InChI=1S/C13H24N2O3S/c1-18-12(16)9-19-8-7-15-13(17)10-5-3-2-4-6-11(10)14/h10-11H,2-9,14H2,1H3,(H,15,17)/t10-,11-/m1/s1 |
| InChIKey | JJDAFLGYHMPRHW-GHMZBOCLSA-N |
| XLogP | 0.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|