C19H16Cl2FN5O3S2 — CID 100632356
2,4-dichloro-N-[5-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 100632356) has the molecular formula C19H16Cl2FN5O3S2 and a molecular weight of 516.41 g/mol. Its IUPAC name is 2,4-dichloro-N-[5-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[5-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100632356 |
| Molecular Formula | C19H16Cl2FN5O3S2 |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | 2,4-dichloro-N-[5-[4-(2-fluorophenyl)piperazin-1-yl]sulfonyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(S(=O)(=O)N2CCN(c3ccccc3F)CC2)s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H16Cl2FN5O3S2/c20-12-5-6-13(14(21)11-12)17(28)23-18-24-25-19(31-18)32(29,30)27-9-7-26(8-10-27)16-4-2-1-3-15(16)22/h1-6,11H,7-10H2,(H,23,24,28) |
| InChIKey | ZBTUPVXIHPBMOR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|