C19H22N2O3S — CID 100633625
(3R,7aR)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 100633625) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is (3R,7aR)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aR)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 100633625 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (3R,7aR)-N-[(1R)-1-(1-benzofuran-2-yl)ethyl]-N,7a-dimethyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@H](c1cc2ccccc2o1)N(C)C(=O)[C@@H]1CS[C@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C19H22N2O3S/c1-12(16-10-13-6-4-5-7-15(13)24-16)20(3)18(23)14-11-25-19(2)9-8-17(22)21(14)19/h4-7,10,12,14H,8-9,11H2,1-3H3/t12-,14+,19-/m1/s1 |
| InChIKey | PEIFWPIWIHJSLH-SPKLELGKSA-N |
| XLogP | 3.41 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |