C16H32O3Si — CID 10063395
cis-(1R,2R,6Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-hydroxyethylidene)-2-methylcyclohexan-1-ol (PubChem CID 10063395) has the molecular formula C16H32O3Si and a molecular weight of 300.51 g/mol. Its IUPAC name is cis-(1R,2R,6Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-hydroxyethylidene)-2-methylcyclohexan-1-ol.
| Compound Name | cis-(1R,2R,6Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-hydroxyethylidene)-2-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 10063395 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | cis-(1R,2R,6Z)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-(2-hydroxyethylidene)-2-methylcyclohexan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)CCC/C(=C/CO)[C@H]1O |
| InChI | InChI=1S/C16H32O3Si/c1-15(2,3)20(5,6)19-12-16(4)10-7-8-13(9-11-17)14(16)18/h9,14,17-18H,7-8,10-12H2,1-6H3/b13-9-/t14-,16-/m1/s1 |
| InChIKey | NUZDNJNTAPGNPI-HHFPWCGMSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|