C12H16NO6P — CID 10063415
(2S)-2-[[methoxy(phenyl)phosphoryl]amino]pentanedioic acid (PubChem CID 10063415) has the molecular formula C12H16NO6P and a molecular weight of 301.24 g/mol. Its IUPAC name is (2S)-2-[[methoxy(phenyl)phosphoryl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[methoxy(phenyl)phosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 10063415 |
| Molecular Formula | C12H16NO6P |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (2S)-2-[[methoxy(phenyl)phosphoryl]amino]pentanedioic acid |
| SMILES | COP(=O)(N[C@@H](CCC(=O)O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H16NO6P/c1-19-20(18,9-5-3-2-4-6-9)13-10(12(16)17)7-8-11(14)15/h2-6,10H,7-8H2,1H3,(H,13,18)(H,14,15)(H,16,17)/t10-,20?/m0/s1 |
| InChIKey | GXNJJDKOTVYWOC-SMNKDYLDSA-N |
| XLogP | 1.06 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|