C16H16BrN — CID 10063462
(6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methanamine (PubChem CID 10063462) has the molecular formula C16H16BrN and a molecular weight of 302.21 g/mol. Its IUPAC name is (6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methanamine.
| Compound Name | (6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methanamine |
|---|---|
| PubChem CID | 10063462 |
| Molecular Formula | C16H16BrN |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methanamine |
| SMILES | NCC1c2ccccc2CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C16H16BrN/c17-13-7-8-15-12(9-13)6-5-11-3-1-2-4-14(11)16(15)10-18/h1-4,7-9,16H,5-6,10,18H2 |
| InChIKey | BSFAXVVEEISITB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |