C17H16N4O3 — CID 100634698
4-[[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid (PubChem CID 100634698) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-[[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid.
| Compound Name | 4-[[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 100634698 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-[[(1-methyl-5-pyrrol-1-ylpyrazole-4-carbonyl)amino]methyl]benzoic acid |
| SMILES | Cn1ncc(C(=O)NCc2ccc(C(=O)O)cc2)c1-n1cccc1 |
| InChI | InChI=1S/C17H16N4O3/c1-20-16(21-8-2-3-9-21)14(11-19-20)15(22)18-10-12-4-6-13(7-5-12)17(23)24/h2-9,11H,10H2,1H3,(H,18,22)(H,23,24) |
| InChIKey | CKQVRXUREFNWDY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |