About (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol
(Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol (PubChem CID 10063472) has the molecular formula C17H19O3P
and a molecular weight of 302.31 g/mol. Its IUPAC name is (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol.
Molecular Properties
| Compound Name | (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol |
| PubChem CID | 10063472 |
| Molecular Formula | C17H19O3P |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol |
| SMILES | C/C(=C/P(=O)(c1ccccc1)c1ccccc1)[C@@H](O)CO |
| InChI | InChI=1S/C17H19O3P/c1-14(17(19)12-18)13-21(20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,13,17-19H,12H2,1H3/b14-13-/t17-/m0/s1 |
| InChIKey | NTLYEKXTPHHRRT-NJWFCXLTSA-N |
| XLogP | 2.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol?
The IUPAC name of (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol (CID 10063472) is (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol.
What is the SMILES notation for (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol?
The canonical SMILES for (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol is C/C(=C/P(=O)(c1ccccc1)c1ccccc1)[C@@H](O)CO.
What is the InChIKey of (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol?
The InChIKey is NTLYEKXTPHHRRT-NJWFCXLTSA-N. The full InChI is InChI=1S/C17H19O3P/c1-14(17(19)12-18)13-21(20,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,13,17-19H,12H2,1H3/b14-13-/t17-/m0/s1.
What are the key properties of (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol?
(Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol has a molecular weight of 302.31 g/mol, XLogP of 2.26, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2R)-4-diphenylphosphoryl-3-methylbut-3-ene-1,2-diol is sourced from PubChem (CID 10063472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).