C31H38ClN3O6S — CID 100634918
(2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100634918) has the molecular formula C31H38ClN3O6S and a molecular weight of 616.18 g/mol. Its IUPAC name is (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100634918 |
| Molecular Formula | C31H38ClN3O6S |
| Molecular Weight | 616.18 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | (2R)-N-butyl-2-[(4-chlorophenyl)methyl-[2-(2,5-dimethoxy-N-methylsulfonylanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)CN(c1cc(OC)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C31H38ClN3O6S/c1-5-6-18-33-31(37)28(19-23-10-8-7-9-11-23)34(21-24-12-14-25(32)15-13-24)30(36)22-35(42(4,38)39)27-20-26(40-2)16-17-29(27)41-3/h7-17,20,28H,5-6,18-19,21-22H2,1-4H3,(H,33,37)/t28-/m1/s1 |
| InChIKey | AMRJEQHRMYSMAC-MUUNZHRXSA-N |
| XLogP | 4.68 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|