C14H15BrN2O3 — CID 100635841
(2S)-2-[(3-bromo-1H-indole-2-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 100635841) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is (2S)-2-[(3-bromo-1H-indole-2-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(3-bromo-1H-indole-2-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 100635841 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | (2S)-2-[(3-bromo-1H-indole-2-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1[nH]c2ccccc2c1Br)C(=O)O |
| InChI | InChI=1S/C14H15BrN2O3/c1-7(2)11(14(19)20)17-13(18)12-10(15)8-5-3-4-6-9(8)16-12/h3-7,11,16H,1-2H3,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | HOKAAMBWRCKXLX-NSHDSACASA-N |
| XLogP | 2.77 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |