C14H18BrNO2S — CID 100637855
3-[(2S)-2-[(4-bromophenyl)sulfanylmethyl]pyrrolidin-1-yl]propanoic acid (PubChem CID 100637855) has the molecular formula C14H18BrNO2S and a molecular weight of 344.27 g/mol. Its IUPAC name is 3-[(2S)-2-[(4-bromophenyl)sulfanylmethyl]pyrrolidin-1-yl]propanoic acid.
| Compound Name | 3-[(2S)-2-[(4-bromophenyl)sulfanylmethyl]pyrrolidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 100637855 |
| Molecular Formula | C14H18BrNO2S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 3-[(2S)-2-[(4-bromophenyl)sulfanylmethyl]pyrrolidin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCC[C@H]1CSc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrNO2S/c15-11-3-5-13(6-4-11)19-10-12-2-1-8-16(12)9-7-14(17)18/h3-6,12H,1-2,7-10H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | JSVJYPHTDIJWNO-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |