About 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol
2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (PubChem CID 10063792) has the molecular formula C14H11BrOS
and a molecular weight of 307.21 g/mol. Its IUPAC name is 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol.
Molecular Properties
| Compound Name | 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| PubChem CID | 10063792 |
| Molecular Formula | C14H11BrOS |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol |
| SMILES | OC1c2ccccc2CSc2ccc(Br)cc21 |
| InChI | InChI=1S/C14H11BrOS/c15-10-5-6-13-12(7-10)14(16)11-4-2-1-3-9(11)8-17-13/h1-7,14,16H,8H2 |
| InChIKey | XVMFFXVKTTYDSY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol?
The IUPAC name of 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol (CID 10063792) is 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol.
What is the SMILES notation for 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol?
The canonical SMILES for 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol is OC1c2ccccc2CSc2ccc(Br)cc21.
What is the InChIKey of 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol?
The InChIKey is XVMFFXVKTTYDSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11BrOS/c15-10-5-6-13-12(7-10)14(16)11-4-2-1-3-9(11)8-17-13/h1-7,14,16H,8H2.
What are the key properties of 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol?
2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol has a molecular weight of 307.21 g/mol, XLogP of 4.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6,11-dihydrobenzo[c][1]benzothiepin-11-ol is sourced from PubChem (CID 10063792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).