C13H15F2N3O2S — CID 100638102
3-[[4-(4,4-difluorocyclohexyl)-1,3-thiazol-2-yl]methyl]imidazolidine-2,4-dione (PubChem CID 100638102) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.35 g/mol. Its IUPAC name is 3-[[4-(4,4-difluorocyclohexyl)-1,3-thiazol-2-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[4-(4,4-difluorocyclohexyl)-1,3-thiazol-2-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 100638102 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 3-[[4-(4,4-difluorocyclohexyl)-1,3-thiazol-2-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1Cc1nc(C2CCC(F)(F)CC2)cs1 |
| InChI | InChI=1S/C13H15F2N3O2S/c14-13(15)3-1-8(2-4-13)9-7-21-10(17-9)6-18-11(19)5-16-12(18)20/h7-8H,1-6H2,(H,16,20) |
| InChIKey | WTNFBKVAEWQJEC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|