C22H27ClO7 — CID 100638389
[(1R,7R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-8a-hydroxy-1-methoxy-7-methyl-6,8-dioxo-1H-isochromen-7-yl] acetate (PubChem CID 100638389) has the molecular formula C22H27ClO7 and a molecular weight of 438.90 g/mol. Its IUPAC name is [(1R,7R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-8a-hydroxy-1-methoxy-7-methyl-6,8-dioxo-1H-isochromen-7-yl] acetate.
| Compound Name | [(1R,7R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-8a-hydroxy-1-methoxy-7-methyl-6,8-dioxo-1H-isochromen-7-yl] acetate |
|---|---|
| PubChem CID | 100638389 |
| Molecular Formula | C22H27ClO7 |
| Molecular Weight | 438.90 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | [(1R,7R,8aR)-5-chloro-3-[(1E,3E,5S)-3,5-dimethylhepta-1,3-dienyl]-8a-hydroxy-1-methoxy-7-methyl-6,8-dioxo-1H-isochromen-7-yl] acetate |
| SMILES | CC[C@H](C)/C=C(C)/C=C/C1=CC2=C(Cl)C(=O)[C@](C)(OC(C)=O)C(=O)[C@]2(O)[C@H](OC)O1 |
| InChI | InChI=1S/C22H27ClO7/c1-7-12(2)10-13(3)8-9-15-11-16-17(23)18(25)21(5,30-14(4)24)19(26)22(16,27)20(28-6)29-15/h8-12,20,27H,7H2,1-6H3/b9-8+,13-10+/t12-,20+,21-,22-/m0/s1 |
| InChIKey | QBTPSJBCRQLPLW-SHJMULCMSA-N |
| XLogP | 3.12 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.90 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|