C17H23FN4O2 — CID 100638669
1-(2,2-dimethoxyethyl)-4-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]piperazine (PubChem CID 100638669) has the molecular formula C17H23FN4O2 and a molecular weight of 334.40 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]piperazine.
| Compound Name | 1-(2,2-dimethoxyethyl)-4-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]piperazine |
|---|---|
| PubChem CID | 100638669 |
| Molecular Formula | C17H23FN4O2 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4-[5-(2-fluorophenyl)-1H-pyrazol-3-yl]piperazine |
| SMILES | COC(CN1CCN(c2cc(-c3ccccc3F)[nH]n2)CC1)OC |
| InChI | InChI=1S/C17H23FN4O2/c1-23-17(24-2)12-21-7-9-22(10-8-21)16-11-15(19-20-16)13-5-3-4-6-14(13)18/h3-6,11,17H,7-10,12H2,1-2H3,(H,19,20) |
| InChIKey | MYDWVCOUYVPWDV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|