C19H32O3 — CID 10063899
1,5,5,12,12-pentamethyl-10,14-dioxadispiro[5.2.59.26]hexadec-1-en-4-ol (PubChem CID 10063899) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is 1,5,5,12,12-pentamethyl-10,14-dioxadispiro[5.2.59.26]hexadec-1-en-4-ol.
| Compound Name | 1,5,5,12,12-pentamethyl-10,14-dioxadispiro[5.2.59.26]hexadec-1-en-4-ol |
|---|---|
| PubChem CID | 10063899 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 1,5,5,12,12-pentamethyl-10,14-dioxadispiro[5.2.59.26]hexadec-1-en-4-ol |
| SMILES | CC1=CCC(O)C(C)(C)C12CCC1(CC2)OCC(C)(C)CO1 |
| InChI | InChI=1S/C19H32O3/c1-14-6-7-15(20)17(4,5)18(14)8-10-19(11-9-18)21-12-16(2,3)13-22-19/h6,15,20H,7-13H2,1-5H3 |
| InChIKey | PFASEYUZNJENDK-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|