C16H18O3 — CID 100639366
[(3R,4E,6E,12E)-3-hydroxytetradeca-4,6,12-trien-8,10-diynyl] acetate (PubChem CID 100639366) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(3R,4E,6E,12E)-3-hydroxytetradeca-4,6,12-trien-8,10-diynyl] acetate.
| Compound Name | [(3R,4E,6E,12E)-3-hydroxytetradeca-4,6,12-trien-8,10-diynyl] acetate |
|---|---|
| PubChem CID | 100639366 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [(3R,4E,6E,12E)-3-hydroxytetradeca-4,6,12-trien-8,10-diynyl] acetate |
| SMILES | C/C=C/C#CC#C/C=C/C=C/[C@H](O)CCOC(C)=O |
| InChI | InChI=1S/C16H18O3/c1-3-4-5-6-7-8-9-10-11-12-16(18)13-14-19-15(2)17/h3-4,9-12,16,18H,13-14H2,1-2H3/b4-3+,10-9+,12-11+/t16-/m0/s1 |
| InChIKey | UMIDUSJZZKFUNM-YFAMCJQNSA-N |
| XLogP | 2.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|