C18H23N3O3 — CID 100639944
(2R)-2-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-N,N-diethyl-2-phenylacetamide (PubChem CID 100639944) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2R)-2-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-N,N-diethyl-2-phenylacetamide.
| Compound Name | (2R)-2-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-N,N-diethyl-2-phenylacetamide |
|---|---|
| PubChem CID | 100639944 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-2-[(7aS)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]-N,N-diethyl-2-phenylacetamide |
| SMILES | CCN(CC)C(=O)[C@@H](c1ccccc1)N1C(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C18H23N3O3/c1-3-19(4-2)17(23)15(13-9-6-5-7-10-13)21-16(22)14-11-8-12-20(14)18(21)24/h5-7,9-10,14-15H,3-4,8,11-12H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | KSQQYGUTSPWZNY-LSDHHAIUSA-N |
| XLogP | 2.02 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|