About 9-Phenoxyacridine
9-Phenoxyacridine (PubChem CID 100640) has the molecular formula C19H13NO
and a molecular weight of 271.30 g/mol. Its IUPAC name is 9-phenoxyacridine.
Molecular Properties
| Compound Name | 9-Phenoxyacridine |
| PubChem CID | 100640 |
| Molecular Formula | C19H13NO |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 9-phenoxyacridine |
| SMILES | C1=CC=C(C=C1)OC2=C3C=CC=CC3=NC4=CC=CC=C42 |
| InChI | InChI=1S/C19H13NO/c1-2-8-14(9-3-1)21-19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H |
| InChIKey | MFCLDPQGJMEEBE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 22.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 316 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-Phenoxyacridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-Phenoxyacridine?
The IUPAC name of 9-Phenoxyacridine (CID 100640) is 9-phenoxyacridine.
What is the SMILES notation for 9-Phenoxyacridine?
The canonical SMILES for 9-Phenoxyacridine is C1=CC=C(C=C1)OC2=C3C=CC=CC3=NC4=CC=CC=C42.
What is the InChIKey of 9-Phenoxyacridine?
The InChIKey is MFCLDPQGJMEEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO/c1-2-8-14(9-3-1)21-19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-13H.
What are the key properties of 9-Phenoxyacridine?
9-Phenoxyacridine has a molecular weight of 271.30 g/mol, XLogP of 5.10, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-Phenoxyacridine is sourced from PubChem (CID 100640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).