C18H34O2Si — CID 10064010
[(1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol (PubChem CID 10064010) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is [(1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol.
| Compound Name | [(1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 10064010 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | [(1S,6S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]methanol |
| SMILES | C[C@H]1CC2C=CCC(CO)C2[C@@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C18H34O2Si/c1-13-10-14-8-7-9-15(12-19)17(14)16(11-13)20-21(5,6)18(2,3)4/h7-8,13-17,19H,9-12H2,1-6H3/t13-,14?,15?,16-,17?/m0/s1 |
| InChIKey | JYWPNUXUECMFRC-VATXVYSQSA-N |
| XLogP | 4.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|