C18H28N4O3 — CID 100640731
methyl (3aS,7aS)-2-[[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]carbamoyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylate (PubChem CID 100640731) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl (3aS,7aS)-2-[[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]carbamoyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylate.
| Compound Name | methyl (3aS,7aS)-2-[[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]carbamoyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylate |
|---|---|
| PubChem CID | 100640731 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | methyl (3aS,7aS)-2-[[(1R)-1-(1,3-dimethylpyrazol-4-yl)ethyl]carbamoyl]-3,4,5,6,7,7a-hexahydro-1H-isoindole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCC[C@@H]1CN(C(=O)N[C@H](C)c1cn(C)nc1C)C2 |
| InChI | InChI=1S/C18H28N4O3/c1-12(15-10-21(3)20-13(15)2)19-17(24)22-9-14-7-5-6-8-18(14,11-22)16(23)25-4/h10,12,14H,5-9,11H2,1-4H3,(H,19,24)/t12-,14-,18-/m1/s1 |
| InChIKey | PMQIKNPWKBJVPC-RVZJWNSFSA-N |
| XLogP | 2.16 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |