C14H24N4S — CID 100641638
2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)thiomorpholine (PubChem CID 100641638) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is 2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)thiomorpholine.
| Compound Name | 2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)thiomorpholine |
|---|---|
| PubChem CID | 100641638 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)thiomorpholine |
| SMILES | CC1(C)CN(Cc2nnc3n2CCCCC3)CCS1 |
| InChI | InChI=1S/C14H24N4S/c1-14(2)11-17(8-9-19-14)10-13-16-15-12-6-4-3-5-7-18(12)13/h3-11H2,1-2H3 |
| InChIKey | SMRXOSLLXLWXGO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |