C14H12ClN5O4S — CID 100643547
2-chloro-4-methyl-N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-5-nitrobenzenesulfonamide (PubChem CID 100643547) has the molecular formula C14H12ClN5O4S and a molecular weight of 381.80 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-4-methyl-N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 100643547 |
| Molecular Formula | C14H12ClN5O4S |
| Molecular Weight | 381.80 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | 2-chloro-4-methyl-N-(7-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccn2c(NS(=O)(=O)c3cc([N+](=O)[O-])c(C)cc3Cl)nnc2c1 |
| InChI | InChI=1S/C14H12ClN5O4S/c1-8-3-4-19-13(5-8)16-17-14(19)18-25(23,24)12-7-11(20(21)22)9(2)6-10(12)15/h3-7H,1-2H3,(H,17,18) |
| InChIKey | KYSSNTSIJWSACU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|