About N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine (PubChem CID 100643650) has the molecular formula C12H21FN2O
and a molecular weight of 228.31 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine |
| PubChem CID | 100643650 |
| Molecular Formula | C12H21FN2O |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine |
| SMILES | Cc1noc(C)c1CN(C)CCCCCF |
| InChI | InChI=1S/C12H21FN2O/c1-10-12(11(2)16-14-10)9-15(3)8-6-4-5-7-13/h4-9H2,1-3H3 |
| InChIKey | FGWMDKHYVPGLRX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine?
The IUPAC name of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine (CID 100643650) is N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine.
What is the SMILES notation for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine?
The canonical SMILES for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine is Cc1noc(C)c1CN(C)CCCCCF.
What is the InChIKey of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine?
The InChIKey is FGWMDKHYVPGLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21FN2O/c1-10-12(11(2)16-14-10)9-15(3)8-6-4-5-7-13/h4-9H2,1-3H3.
What are the key properties of N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine?
N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine has a molecular weight of 228.31 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-5-fluoro-N-methylpentan-1-amine is sourced from PubChem (CID 100643650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).