C12H15F4N3 — CID 100643956
(2R)-2-N-cyclopropyl-2-N-methyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,2-diamine (PubChem CID 100643956) has the molecular formula C12H15F4N3 and a molecular weight of 277.26 g/mol. Its IUPAC name is (2R)-2-N-cyclopropyl-2-N-methyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,2-diamine.
| Compound Name | (2R)-2-N-cyclopropyl-2-N-methyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 100643956 |
| Molecular Formula | C12H15F4N3 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (2R)-2-N-cyclopropyl-2-N-methyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)propane-1,2-diamine |
| SMILES | C[C@H](CNc1c(F)c(F)nc(F)c1F)N(C)C1CC1 |
| InChI | InChI=1S/C12H15F4N3/c1-6(19(2)7-3-4-7)5-17-10-8(13)11(15)18-12(16)9(10)14/h6-7H,3-5H2,1-2H3,(H,17,18)/t6-/m1/s1 |
| InChIKey | QUFLGCUUDPKAGY-ZCFIWIBFSA-N |
| XLogP | 2.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|