About 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane
4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane (PubChem CID 100644193) has the molecular formula C13H24FNO2
and a molecular weight of 245.34 g/mol. Its IUPAC name is 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane |
| PubChem CID | 100644193 |
| Molecular Formula | C13H24FNO2 |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane |
| SMILES | FCCCCCN1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C13H24FNO2/c14-6-2-1-3-7-15-8-11-17-13(12-15)4-9-16-10-5-13/h1-12H2 |
| InChIKey | GIDKGBZVKDPDNF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The IUPAC name of 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane (CID 100644193) is 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane.
What is the SMILES notation for 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The canonical SMILES for 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane is FCCCCCN1CCOC2(CCOCC2)C1.
What is the InChIKey of 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane?
The InChIKey is GIDKGBZVKDPDNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24FNO2/c14-6-2-1-3-7-15-8-11-17-13(12-15)4-9-16-10-5-13/h1-12H2.
What are the key properties of 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane?
4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane has a molecular weight of 245.34 g/mol, XLogP of 2.01, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-fluoropentyl)-1,9-dioxa-4-azaspiro[5.5]undecane is sourced from PubChem (CID 100644193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).