C13H20F3N5O2 — CID 100644245
4-(5-methyl-1H-pyrazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-carboxamide (PubChem CID 100644245) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 4-(5-methyl-1H-pyrazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-(5-methyl-1H-pyrazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 100644245 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 4-(5-methyl-1H-pyrazol-3-yl)-N-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-1-carboxamide |
| SMILES | Cc1cc(N2CCN(C(=O)NCCOCC(F)(F)F)CC2)n[nH]1 |
| InChI | InChI=1S/C13H20F3N5O2/c1-10-8-11(19-18-10)20-3-5-21(6-4-20)12(22)17-2-7-23-9-13(14,15)16/h8H,2-7,9H2,1H3,(H,17,22)(H,18,19) |
| InChIKey | OVUWGAZAXJXEKP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|