C15H30O3SSi — CID 10064508
4-(3,4-dihydro-2H-thiopyran-6-yl)-3-(2-trimethylsilylethoxymethoxy)butan-1-ol (PubChem CID 10064508) has the molecular formula C15H30O3SSi and a molecular weight of 318.56 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-thiopyran-6-yl)-3-(2-trimethylsilylethoxymethoxy)butan-1-ol.
| Compound Name | 4-(3,4-dihydro-2H-thiopyran-6-yl)-3-(2-trimethylsilylethoxymethoxy)butan-1-ol |
|---|---|
| PubChem CID | 10064508 |
| Molecular Formula | C15H30O3SSi |
| Molecular Weight | 318.56 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-(3,4-dihydro-2H-thiopyran-6-yl)-3-(2-trimethylsilylethoxymethoxy)butan-1-ol |
| SMILES | C[Si](C)(C)CCOCOC(CCO)CC1=CCCCS1 |
| InChI | InChI=1S/C15H30O3SSi/c1-20(2,3)11-9-17-13-18-14(7-8-16)12-15-6-4-5-10-19-15/h6,14,16H,4-5,7-13H2,1-3H3 |
| InChIKey | LOUSLFAUOUJOHW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|