About ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate
ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate (PubChem CID 10064526) has the molecular formula C13H9N3O5S
and a molecular weight of 319.30 g/mol. Its IUPAC name is ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate |
| PubChem CID | 10064526 |
| Molecular Formula | C13H9N3O5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2sc3ccc([N+](=O)[O-])cc3n2c1=O |
| InChI | InChI=1S/C13H9N3O5S/c1-2-21-12(18)8-6-14-13-15(11(8)17)9-5-7(16(19)20)3-4-10(9)22-13/h3-6H,2H2,1H3 |
| InChIKey | RYSIUMNTYMLXFE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The IUPAC name of ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate (CID 10064526) is ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate.
What is the SMILES notation for ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The canonical SMILES for ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate is CCOC(=O)c1cnc2sc3ccc([N+](=O)[O-])cc3n2c1=O.
What is the InChIKey of ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
The InChIKey is RYSIUMNTYMLXFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N3O5S/c1-2-21-12(18)8-6-14-13-15(11(8)17)9-5-7(16(19)20)3-4-10(9)22-13/h3-6H,2H2,1H3.
What are the key properties of ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate?
ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate has a molecular weight of 319.30 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-nitro-4-oxopyrimido[2,1-b][1,3]benzothiazole-3-carboxylate is sourced from PubChem (CID 10064526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).