C13H18N4O2 — CID 100645424
(4aS,8aS)-4-(2-methylpyrazole-3-carbonyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one (PubChem CID 100645424) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is (4aS,8aS)-4-(2-methylpyrazole-3-carbonyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one.
| Compound Name | (4aS,8aS)-4-(2-methylpyrazole-3-carbonyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
|---|---|
| PubChem CID | 100645424 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (4aS,8aS)-4-(2-methylpyrazole-3-carbonyl)-1,3,4a,5,6,7,8,8a-octahydroquinoxalin-2-one |
| SMILES | Cn1nccc1C(=O)N1CC(=O)N[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C13H18N4O2/c1-16-11(6-7-14-16)13(19)17-8-12(18)15-9-4-2-3-5-10(9)17/h6-7,9-10H,2-5,8H2,1H3,(H,15,18)/t9-,10-/m0/s1 |
| InChIKey | UGKOCJNXNJJAPZ-UWVGGRQHSA-N |
| XLogP | 0.30 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |