C21H19N3O — CID 100646183
N-(1-benzylpyrazol-4-yl)-7,8-dihydronaphthalene-2-carboxamide (PubChem CID 100646183) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)-7,8-dihydronaphthalene-2-carboxamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)-7,8-dihydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 100646183 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)-7,8-dihydronaphthalene-2-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2ccccc2)c1)c1ccc2c(c1)CCC=C2 |
| InChI | InChI=1S/C21H19N3O/c25-21(19-11-10-17-8-4-5-9-18(17)12-19)23-20-13-22-24(15-20)14-16-6-2-1-3-7-16/h1-4,6-8,10-13,15H,5,9,14H2,(H,23,25) |
| InChIKey | XNBMTWFESVKDFN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |