C14H24O4S2 — CID 10064647
(4R,5R)-4-[(1R)-2-(1,3-dithian-2-yl)-1-methoxyethyl]-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane (PubChem CID 10064647) has the molecular formula C14H24O4S2 and a molecular weight of 320.48 g/mol. Its IUPAC name is (4R,5R)-4-[(1R)-2-(1,3-dithian-2-yl)-1-methoxyethyl]-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane.
| Compound Name | (4R,5R)-4-[(1R)-2-(1,3-dithian-2-yl)-1-methoxyethyl]-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane |
|---|---|
| PubChem CID | 10064647 |
| Molecular Formula | C14H24O4S2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | (4R,5R)-4-[(1R)-2-(1,3-dithian-2-yl)-1-methoxyethyl]-2,2-dimethyl-5-[(2R)-oxiran-2-yl]-1,3-dioxolane |
| SMILES | CO[C@H](CC1SCCCS1)[C@H]1OC(C)(C)O[C@@H]1[C@H]1CO1 |
| InChI | InChI=1S/C14H24O4S2/c1-14(2)17-12(13(18-14)10-8-16-10)9(15-3)7-11-19-5-4-6-20-11/h9-13H,4-8H2,1-3H3/t9-,10-,12-,13-/m1/s1 |
| InChIKey | NEABRTPGNIULNF-FPQZTECRSA-N |
| XLogP | 2.51 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|