C21H23NO2 — CID 10064690
(4R,9aR)-9a-benzyl-4-phenyl-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,4]oxazin-1-one (PubChem CID 10064690) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (4R,9aR)-9a-benzyl-4-phenyl-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,4]oxazin-1-one.
| Compound Name | (4R,9aR)-9a-benzyl-4-phenyl-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,4]oxazin-1-one |
|---|---|
| PubChem CID | 10064690 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (4R,9aR)-9a-benzyl-4-phenyl-3,4,6,7,8,9-hexahydropyrido[2,1-c][1,4]oxazin-1-one |
| SMILES | O=C1OC[C@@H](c2ccccc2)N2CCCC[C@@]12Cc1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c23-20-21(15-17-9-3-1-4-10-17)13-7-8-14-22(21)19(16-24-20)18-11-5-2-6-12-18/h1-6,9-12,19H,7-8,13-16H2/t19-,21+/m0/s1 |
| InChIKey | BAUAMYLUJPLHKB-PZJWPPBQSA-N |
| XLogP | 3.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |