C14H15N5O2 — CID 100647082
[(3S)-3-pyrazin-2-yloxypiperidin-1-yl]-pyrimidin-2-ylmethanone (PubChem CID 100647082) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is [(3S)-3-pyrazin-2-yloxypiperidin-1-yl]-pyrimidin-2-ylmethanone.
| Compound Name | [(3S)-3-pyrazin-2-yloxypiperidin-1-yl]-pyrimidin-2-ylmethanone |
|---|---|
| PubChem CID | 100647082 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | [(3S)-3-pyrazin-2-yloxypiperidin-1-yl]-pyrimidin-2-ylmethanone |
| SMILES | O=C(c1ncccn1)N1CCC[C@H](Oc2cnccn2)C1 |
| InChI | InChI=1S/C14H15N5O2/c20-14(13-17-4-2-5-18-13)19-8-1-3-11(10-19)21-12-9-15-6-7-16-12/h2,4-7,9,11H,1,3,8,10H2/t11-/m0/s1 |
| InChIKey | VMKHIAVFFVFBCN-NSHDSACASA-N |
| XLogP | 0.95 |
| TPSA | 81.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |