C17H25NO2 — CID 100647084
[(3R)-3-[[(1R,3R)-3-benzylcyclopentyl]amino]oxolan-3-yl]methanol (PubChem CID 100647084) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is [(3R)-3-[[(1R,3R)-3-benzylcyclopentyl]amino]oxolan-3-yl]methanol.
| Compound Name | [(3R)-3-[[(1R,3R)-3-benzylcyclopentyl]amino]oxolan-3-yl]methanol |
|---|---|
| PubChem CID | 100647084 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | [(3R)-3-[[(1R,3R)-3-benzylcyclopentyl]amino]oxolan-3-yl]methanol |
| SMILES | OC[C@]1(N[C@@H]2CC[C@H](Cc3ccccc3)C2)CCOC1 |
| InChI | InChI=1S/C17H25NO2/c19-12-17(8-9-20-13-17)18-16-7-6-15(11-16)10-14-4-2-1-3-5-14/h1-5,15-16,18-19H,6-13H2/t15-,16-,17-/m1/s1 |
| InChIKey | VQFKFJKDDCZQBN-BRWVUGGUSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |